Photo：010-62890160
| Biological Activity | |||||||||||||||||||||||||
| Synonyms | pifithrin-α. p53 inhibitor, pifithrin-alpha analog | ||||||||||||||||||||||||
| Chemical Name | 2-(4-Methylphenyl)imidazo[2,1-b]-5,6,7,8-tetrahydrobenzothiazole | ||||||||||||||||||||||||
| Application | Cyclic Pifithrin-α hydrobromide is a cyclic analog of pifithrin-α | ||||||||||||||||||||||||
| CAS Number | 511296-88-1 | ||||||||||||||||||||||||
| Purity | ≥99.5% | ||||||||||||||||||||||||
| Molecular Weight | 349.29 | ||||||||||||||||||||||||
| Molecular Formula | C₁₆H₁₇BrN₂S | ||||||||||||||||||||||||
| SMILES | CC1=CC=C(C=C1)C2=CN3C4=C(CCCC4)SC3=N2.Br | ||||||||||||||||||||||||
| Target & IC50 | Mus musculus: EC5050 = 2.5 μM | ||||||||||||||||||||||||
| Shipping | Gel Pack | ||||||||||||||||||||||||
| Storage | Store at -20°C | ||||||||||||||||||||||||
|
|||||||||||||||||||||||||
| Solubility | |
| DMSO: 27 mg/mL (77.30 mM)
Ethanol: 3 mg/mL (8.59 mM) |
| Product Description | |
Cyclic Pifithrin-alpha is a reversible and cell-permeable inhibitor of p53, which plays a crucial role in apoptosis, angiogenesis, and genomic stability. The cyclic form is the more stable and less cytotoxic version of the molecule. It is reported to be capable of increasing the efficiency of inducing pluripotent stem cells. |
